> Succinic acid for synthesis. Chemsrc provides Diammonium succinate(CAS#:2226-88-2) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. Carboxylic acid can infinite esters obtained from carboxylic All India; Mumbai; Bio-Tech Grade Powder … It does not dissolve in benzene, carbon sulfide, carbon tetrachloride or oil ether. ILO International Chemical Safety Cards (ICSC) 3.2.4 Flash Point. Succinic Succinic acid, also called Butanedioic Acid, a dicarboxylic acid of molecular formula C 4 H 6 O 4 that is widely distributed in almost all plant and animal tissues and that plays a significant role in intermediary metabolism. Succinic acid can also be produced via anaerobic fermentation, especially from sources like starch and different C5 and C6 sugars (Werpy et al., 2006).A very prominent example is the microorganism Basfia succiniciproducens, which was extracted from a cow rumen (Scholten et al., 2009).The specific feature of the microorganism is the consumption of one molecule of carbon dioxide in each molecule of succinic … Acid(Nonanedioic Acid), 100 14, 126 CAS: 110-15-6 MDL: MFCD00002789 EINECS: 203-740-4 Synonyms: 1,4-Butanedioic acid Biological buffers are useful for cell culture in vitro, enzyme assays and … Chemsrc provides Succinic acid(CAS#:110-15-6) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. Succinic - 129 C, 245 7, Pimelic PHYSICAL - 114 C, C Succinic acid Butanediol: Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Less<< Succinic acid MSDS (material safety data sheet) or SDS, CoA and CoQ, dossiers, brochures and other available documents. 6, Adipic The carboxylate anion is called 'succinate and esters of succinic acid are called alkyl succinates. Succinic acid is a colorless crystalline solid with a melting point of 185-187° C. It is soluble in water, slightly dissolves in ethanol, ether, acetone and glycerine. # DEREK, a knowledge-based systemr epeatedly cited in the Guidance on information requirements and chemical safety assessment, Chapter R.6 "QSARs and grouping of chemicals" was applied to succinic acid and also to the chemically analogous substances fumaric acid and maleic acid. Does anyone know? at 100 mmHg, C Point, C Type of study provided. Specifications of Succinic Acid Analytical Reagent Grade: Butanedioic Acid HOOCCH2CH2COOH --- Formula Weight 118.09 CAS Number 110-15-6. REQUIREMENTS Assay: 99.0% HOOCCH2CH2COOH Melting point: 185C-191C . photographic chemicals, alkyd resins, plasticizer, Metal treatment chemical, vehicle water cooling systems and 186-188 °C Alfa Aesar: 185 °C Indofine [15-0400] , [15-0400] : 185 °C OU Chemical Safety Data (No longer updated) More details: 184-189 °C Merck Millipore 3821, 822260: 185 °C Jean-Claude Bradley Open Melting Point Dataset 16121: 186.5 °C Jean-Claude Bradley Open Melting Point Dataset 16582: 188 °C Jean-Claude Bradley Open Melting Point Dataset 13519, 22290, 28530 It is soluble in water and slightly soluble in ethanol for the preparation of pentaheterocyclic compounds.Specification:Test ItemsSp Acid(Pentanedioic Information on Registered Substances comes from registration dossiers which have been assigned a registration number. Preparation. Succinic Acid or Butanedioic Acid SDS, Safety Data Sheet MSDS, Material Safety Data Sheet 20-Nov-20. … New Window-21.0 °C. Amber Acid. vitamins) and agrochemicals … C at 10 mmHg, C Practically insol in benzene, carbon disulfide, carbon tetrachloride, petr ether. CopyCopied, CSID:1078, http://www.chemspider.com/Chemical-Structure.1078.html (accessed 23:41, Jan 7, 2021) The melting point (T m), heat of fusion ΔH m ... L-Lactide (LLA), succinic acid (SA) and 2-methyl-1,3-propanediol (MP) were purchased from Tokyo Chemical Industry. amides, and nitriles for the application of drug, Melting point 237°F. Butanedioic acid, 2-phenyl-10424-29-0. 2. IndiaMART. EINECS 211-238-1. point, and other physical and chemical properties for the proper application 9, Azelaic Chemsrc provides Succinic acid(CAS#:110-15-6) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. CAMEO Chemicals. MFCD00004256.alpha.-Phenylsuccinic acid. carbon sulfide, carbon tetrachloride and oil ether. C, 302 Succinic acid has a melting point of 185 °C and a boiling point of 235 °C. Molecular formula of anthracene = C 18 H 10. 90 °C c.c. 16, 124 Succinic acid CAS 110-15-6 cryst., EMPROVE® ESSENTIAL NF,JPE,ACS - Find MSDS or SDS, a COA, data sheets and more information. Articles of Diammonium succinate are included as well. 18 Products. Download MSDS File. Melting Points of Urea and Succinic Acid 1. Succinic anhydride is a cyclic dicarboxylic anhydride and a tetrahydrofurandione. SECTION 1. 2-Phenyl-succinic acid. Acid(Heptanedioic Acid), 105 18, Octadecanedioic oxidized to carbon dioxide and water to provide energy in the form of C, C Succinic Acid of NIPPON SHOKUBAI has not only been used as food additives but also biodegradable polymers, bath additives, plating agents, photochemicals and so on. There are almost Specifications of Succinic Acid Analytical Reagent Grade: Butanedioic Acid HOOCCH2CH2COOH --- Formula Weight 118.09 CAS Number 110-15-6. EPA DSSTox-21°C. Butanedioic acid, phenyl-Succinic acid, phenyl-2-Phenylsuccinate. length (Straight), CAS 1.3 Details of the supplier of the safety data sheet Company : Central Drug House (P) Ltd 7/28 Vardaan House New Delhi-10002 INDIA Telephone : +91 11 49404040 Email : care@cdhfinechemical.com 1.4 … PRODUCT IDENTIFICATION. New Window. in intermediary metabolism (Krebs cycle) in the body. The common method of synthesis of succinic acid is the catalytic hydrogenation of maleic acid or its anhydride. 3.2.3 Melting Point. 3 Chemical and Physical Properties Expand this … Polybutylene succinate (PBS), classed as biopolymer, was synthesized by condensation of succinic acid with a lower excess of (1, 4) butanediol. C at 15 mmHg, C Succinic acid (HOOCCH 2 CH 2 COOH) is a dicarboxylic acid which plays an important role in the citric acid cycle.The name comes from Latin succinum, meaning amber, from which the acid was first isolated.The carboxylate anion is called succinate. Phenylsuccinicacid. Determine the melting point range of urea, then the melting point range of succinic acid . - 134 One gram dissolves in 13 ml cold water, 1 ml boiling water, 18.5 ml alcohol, 6.3 ml methanol, 36 ml acetone, 20 ml glycerol, 113 ml ether. - 110 C, C - 144 c acid cycle. Esters Moderately toxic and an irritant. The monograph also details the following specifications and corresponding tests for verifying that a substance meets ACS Reagent Grade specifications including: Assay, Melting Point, Insoluble … ether, acetone and glycerine; not dissolved in benzene, The common method of synthesis of succinic acid is the The carboxylate anion is called succinate and esters of succinic acid are called alkyl succinates. Succinic acid, (HOOCCH 2 CH 2 COOH), is a dicarboxylic acid which plays an important role in the citric acid cycle.The name comes from Latin succinum, meaning amber, from which the acid was first isolated.The carboxylate anion is called succinate. Phenylsuccinate. ILO International Chemical Safety Cards (ICSC) 3.2.5 Solubility. 5, Glutaric sequence process of enzymatic reaction which a two-carbon acetyl unit is acid, arboxylic acid can 1 Structures Expand this section. SDS; CoA; Certificates; Synonyms: Butanedioic acid EC Number: 203-740-4 Molar Mass: 118.09 g/mol Chemical Formula: HOOCCH₂CH₂COOH CAS #: 110 … C&L Inventory . THF and toluene were purchased from … Human Metabolome Database (HMDB)-21 °C. coupling agents. Succinic acid - cas 110-15-6, synthesis, structure, density, melting point, boiling point acid of four carbon atoms. Acid(Butanedioic Acid), 185 The full spectrum can only be viewed using a FREE account. However, under the "many useful applications" described for the products obtained, the use as a size has not yet been mentioned. Infobox references: Polybutylene succinate (PBS) (sometimes written polytetramethylene succinate) is a thermoplastic polymer resin of … It derives from a succinic acid. AND CHEMICAL PROPERTIES, moderately Synonym: Butanedioic acid CAS Number: 110-15-6. As a good "C4" platform compounds, Succinic acid has been widely used in food, chemical, pharmaceutical industry and other fields. Succinic acid can also be used as analytical reagent and flavoring agents. Tetrahydrofuran (THF) was used as an eluent at a flow rate of 1.0 mL/min at 40 °C. CAS Number: 110-15-6 EINECS EC Number: 203-740-4 Molecular Formula: HOOCCH2CH2COOH Molecular Weight: 118.09 Relevant uses and uses advised against (if any): Industrial Manufacturing. IDENTIFICATION, GENERAL pH of 0.1 molar aq soln 2.7. Reactions. Biochemical role. DESCRIPTION OF, Propanedioic Succinic acid is a colourless crystalline solid with a melting point of 185 -187 C; soluble in water; slightly dissolved in ethanol, ether, acetone and glycerine; not dissolved in benzene, carbon sulfide, carbon tetrachloride and oil ether. CopyCopied, KDYFGRWQOYBRFD-UHFFFAOYSA-N 110-15-6. ChEBI. catalytic hydrogenation of maleic acid or its anhydride. C, 230 Succinic Acid (75 products available) View by: Product | Supplier. to white crystalline power, HEAVY METAL (As Pb Succinic Acid CAS NO. are formed by removal of water from an acid and an alcohol. Physical: Vapor-phase succinic acid is degraded in the atmosphere by reaction with photochemically-produced hydroxyl radicals; the half-life for this reaction in air is estimated to be about 5.8 days. I'm looking at their structures, and they're practically identical, except succinic acid has a (CH2)2 group and adipic acid has (CH2)4 in the middle of their structures, but succinic acid has a much higher melting point. - 99 It is a diprotic acid. This monograph for Succinic Acid provides, in addition to common physical constants, a general description including typical appearance, applications, change in state (approximate), aqueous solubility, and pKa. uses. … Acid (Hexanedioic Acid), 151 Carboxylic acid Succinic acid CAS No. Insoluble Solubility in chloroform: Soluble Related compounds Related Monomers. Organic Compound; Drug; Food Toxin; Dietary Supplement; Micronutrient; Metabolite; Nutraceutical; Animal Toxin; Natural Compound; Supplement, ORL-RAT LD50 2260 mg kg-1, IPR-MUS LD50 2702 mg kg-1, IVN-MUS LD50 1400 mg kg-1, P261-P280-P305+P351+P338-P304+P340-P405-P501a, WARNING: Causes GI injury, skin and eye irritation. Sublimes at 239°F at 5 mm Hg pressure; and at 198°F and 1 mm Hg pressure. Under these conditions, it is possible to substitute succinic acid for its anhydride obtaining the same results. Melting Point >186ºC (dec.) Molecular Weight: 122.06: Storage: Refrigerator: Solubility: Methanol (Slightly), Water (Slightly) Category: Building Blocks; Isotopic Labeled Analogues; Applications: Succinic Acid-13C4 is a compound useful in organic synthesis. Higher chain compounds are used as components in metalworking Succinic anhydride appears as colorless needles or white crystalline solid. Molecular Weight: 118.09 . Melting Point ℃ 185 min. Other identifiers. agents textile treatments and emollients, They are also used as intermediates 10, Sebacic provide a wide range of viscosity, specific gravity, vapor pressure, boiling 30% higher reaction yields were achieved with … Colorless acyl halides, anhydrides, esters, Human Metabolome Database (HMDB) Solubility in water, g/100ml … It has a melting point of 185 °C and a boiling point of 235 °C. C, C Moderately toxic and an irritant. Succinic acid is a kind of common natural organic acid, due to it’s from amber distilled in 1550 for the first time, so the Succinic acid is also known as Amber acid. Get Best Price. Location. 119.5 °C Jean-Claude Bradley Open Melting Point Dataset 15725: 119 °C Jean-Claude Bradley Open Melting Point Dataset 20509: 120 °C Jean-Claude Bradley Open Melting Point Dataset 8430: 118-121 °C Alfa Aesar A12245: 118-120 °C SynQuest 59334, 118-120 °C Oakwood [339548] 119 °C FooDB FDB010338: 118-120 °C SynQuest 59334, 2H26-1-X5 Quality Management Dossier; Operational Excellence Dossier; SDS; CoA; Certificates ; Material Qualification Dossier; Synonyms: Butanedioic acid Molar Mass: 118.09 g/mol Chemical Formula: HOOCCH₂CH₂COOH EC Number: 203-740-4 Hill Formula: C₄H₆O₄ CAS #: 110-15-6 … An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. 110-15-6Nature and use: A white crystal with a melting point of 185 ℃, a boiling point of 235 ℃ (decomposed into anhydrides) and a specific gravity of 1.572. It occurs naturally in plant Physical: Vapor-phase succinic acid is degraded in the atmosphere by reaction with photochemically-produced hydroxyl radicals; the half-life for this reaction in air is estimated to be about 5.8 days. REQUIREMENTS Assay: 99.0% HOOCCH2CH2COOH Melting point: 185C-191C . 19.1 mg/mL at 25 °C. The assignment of a registration number does however not guarantee that the information in the dossier is … This monograph for Succinic Acid provides, in addition to common physical constants, a general description including typical appearance, applications, change in state (approximate), aqueous solubility, and pKa. CopyCopied, InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) Acid), Pentanedioic #, Melting C(CC(=O)O)C(=O)O At room temperature, pure succinic acid is a solid that forms colorless, odorless crystals. Near Me. Melting point: 115 °C (239 °F; 388 K) Solubility in water. Item Unit Specification; Appearance--White crystalline powder: Assay % 99.0 min. IndiaMART > Pharma Ingredients & Raw Materials > API Intermediate > Succinic Acid. and animal tissues. 15, C Acid). It is a colourless crystalline solid, soluble in water, with a … It is a white, odorless solid. Help. 0.11 M. EPA . The method does not seem to give con­ sistent yields and, therefore, we have employed zinc chloride as the condensing agent instead, using a temperature of 170-80°. 2, 189 ... Melting/freezing point at 101 325 Pa provides information on the substance melting/freezing point in °C at a pressure of 101 325 Pa. - 153 Acid(Decanedioic Acid), 131 melting point” quickly, and then repeat with more care for a more precise reading. It is soluble in water and slightly soluble in ethanol for the preparation of pentaheterocyclic compounds.Specification:Test ItemsSp agriculture, and food products, and other industrial Succinic acid is a colourless crystalline solid with a melting point of 185 -187 C; soluble in … 99.0 % Melting point: 185.0 to 189.0 °C: Solubility in hot Water Succinic Acid is industrially produced by hydrogenation of Maleic Anhydride. 13, 112 esters are used as flavouring base materials, plasticizers, solvent carriers and rmediate metabolite in the citric acid cycle. yield Sigma-Aldrich offers a number of Succinic acid products. Physical-chemical properties. PRODUCT Packing: in 25kg bags All Products. DEREK did not find any substructures in its database that fired an alert that would predict succinic acid to be toxic or … In the laboratory, this material can be prepared by dehydration of succinic acid.Such dehydration can occur with the help of acetyl chloride or phosphoryl chloride, or thermally.. Industrially, succinic anhydride is prepared by catalytic hydrogenation of maleic anhydride.. It was discovered in the year 1550 when Dr.Agricola with Germany distilled amber. Acid), C 11, 109 C, C (-)-4'-desmethyl-epipodophyllotoxin biosynthesis, 2-oxoglutarate + L-arginine + oxygen -> succinate + CO2 + guanidinium + (S)-1-pyrroline-5-carboxylate + H2O + H+, 3 2-oxoglutarate + L-arginine + 3 oxygen + 3 H+ -> 2 ethene + 7 CO2 + succinate + guanidinium + (S)-1-pyrroline-5-carboxylate + 3 H2O, a (2R,3S,4S)-leucoanthocyanidin + 2-oxoglutarate + oxygen + H+ -> an anthocyanidin with a 3-hydroxy group + succinate + CO2 + 2 H2O, aerobic respiration III (alternative oxidase pathway), anthocyanin biosynthesis (delphinidin 3-O-glucoside), anthocyanin biosynthesis (pelargonidin 3-O-glucoside), fumarate[in] + a menaquinol[membrane] -> succinate[in] + a menaquinone[membrane], fumarate[in] + a rhodoquinol[membrane] -> succinate[in] + a rhodoquinone[membrane], fumarate[in] + an electron-transfer quinol[membrane] -> succinate[in] + an electron-transfer quinone[membrane], gibberellin biosynthesis I (non C-3, non C-13 hydroxylation), gibberellin biosynthesis II (early C-3 hydroxylation), gibberellin biosynthesis III (early C-13 hydroxylation), gibberellin inactivation I (2beta-hydroxylation), homocysteine and cysteine interconversion, hydroxylated mugineic acid phytosiderophore biosynthesis, leucopelargonidin and leucocyanidin biosynthesis, pentalenolactone D + 2 2-oxoglutarate + 2 oxygen -> pentalenolactone F + 2 succinate + 2 CO2 + H2O, polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium), polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium), proanthocyanidins biosynthesis from flavanols, succinate[in] + a ubiquinone[membrane] -> fumarate[in] + an ubiquinol[membrane], succinate[in] + an electron-transfer quinone[membrane] -> fumarate[in] + an electron-transfer quinol[membrane], succinate[mitochondrial lumen] + a ubiquinone[mitochondrial lumen] -> fumarate[mitochondrial lumen] + an ubiquinol[mitochondrial lumen], superpathway of glyoxylate cycle and fatty acid degradation, superpathway of hyoscyamine and scopolamine biosynthesis, superpathway of scopolin and esculin biosynthesis, (-)-yatein + 2-oxoglutarate + oxygen -> (-)-deoxypodophyllotoxin + succinate + CO2 + H2O, (+)-dihydrokaempferol + 2-oxoglutarate + oxygen -> kaempferol + succinate + CO2 + H2O + H+, (+)-dihydromyricetin + 2-oxoglutarate + oxygen -> myricetin + succinate + CO2 + H2O, (+)-taxifolin + 2-oxoglutarate + oxygen -> quercetin + succinate + CO2 + H2O, (2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + oxygen -> delphinidin + CO2 + succinate + H+ + 2 H2O, (2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + oxygen -> (4S)-2,3-dehydroleucopelargonidin + succinate + CO2 + H2O + 2 H+, (2S)-dihydrotricetin + 2-oxoglutarate + oxygen -> (+)-dihydromyricetin + succinate + CO2, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> (+)-taxifolin + CO2 + succinate, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> (+)-taxifolin + succinate + CO2, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> luteolin + succinate + CO2 + H2O, (2S)-naringenin + 2-oxoglutarate + oxygen -> (+)-dihydrokaempferol + succinate + CO2, (2S)-naringenin + 2-oxoglutarate + oxygen -> apigenin + succinate + CO2 + H2O + H+, (2S)-naringenin + 2-oxoglutarate + oxygen -> CO2 + succinate + (+)-dihydrokaempferol, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> (+)-pinobanksin + CO2 + succinate, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> (+)-pinobanksin + succinate + CO2, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> chrysin + succinate + CO2 + H2O, (6S)-hydroxyhyoscyamine + 2-oxoglutarate + oxygen -> scopolamine + succinate + CO2 + H+ + H2O, (S)-atropinium + 2-oxoglutarate + oxygen -> (6S)-hydroxyhyoscyamine + succinate + CO2, (S)-dihydroorotate + fumarate -> orotate + succinate, 2'-deoxymugineate + 2-oxoglutarate + oxygen -> 3-epihydroxy-2'-deoxymugineate + succinate + CO2 + H+, 2'-deoxymugineate + 2-oxoglutarate + oxygen -> mugineate + succinate + CO2 + H+, 2-oxoglutarate + (S)-atropinium + oxygen -> CO2 + succinate + (6S)-hydroxyhyoscyamine, 2-oxoglutarate + 3,7,4'-trimethylquercetin + 3,7,4'-trimethylquercetin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + 3,7,4'-trimethylquercetagetin + succinate + CO2, 2-oxoglutarate + 3,7-dimethylquercetin + 3,7-dimethylquercetin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + 3,7-dimethylquercetagetin + 3,7-dimethylquercetagetin + succinate + CO2, 2-oxoglutarate + 8-hydroxy-salvigenin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + formaldehyde + pilosin + formaldehyde + succinate + CO2, 2-oxoglutarate + apiforol + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + apigeninidin + succinate + CO2 + 2 H2O + 2 H2O, 2-oxoglutarate + desacetoxyvindoline + oxygen -> CO2 + succinate + 17-O-deacetylvindoline, 2-oxoglutarate + gardenin B + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + formaldehyde + nevadensin + formaldehyde + succinate + CO2, 2-oxoglutarate + luteoforol + 2-oxoglutarate + H+ + oxygen + oxygen + H+ -> CO2 + succinate + luteolinidin + succinate + CO2 + 2 H2O + 2 H2O, 3,7,4'-trimethylquercetin + 2-oxoglutarate + oxygen -> 3,7,4'-trimethylquercetagetin + succinate + CO2, 4-coumaroyl-CoA + 2-oxoglutarate + oxygen -> 2,4-dihydroxycinnamoyl-CoA + succinate + CO2, a (2R,3S,4S)-leucoanthocyanidin + 2-oxoglutarate + oxygen -> a (4S)- 2,3-dehydroflavan-3,4-diol + succinate + CO2 + H2O, apiforol + 2-oxoglutarate + oxygen -> apigeninidin + succinate + CO2 + 2 H2O, codeine + 2-oxoglutarate + oxygen -> morphine + formaldehyde + succinate + CO2, desacetoxyvindoline + 2-oxoglutarate + oxygen -> 17-O-deacetylvindoline + succinate + CO2, desacetoxyvindorosine + 2-oxoglutarate + oxygen -> deacetylvindorosine + succinate + CO2, DIBOA-beta-D-glucoside + 2-oxoglutarate + oxygen -> TRIBOA-beta-D-glucoside + succinate + CO2, D-threo-isocitrate -> glyoxylate + succinate, ferulate + 2-oxoglutarate + oxygen -> (E)-6'-hydroxyferulate + succinate + CO2, feruloyl-CoA + 2-oxoglutarate + oxygen -> 6'-hydroxyferuloyl-CoA + succinate + CO2, fumarate[in] + 2 H+[in] + 2 e-[membrane] -> succinate[in], gamma-butyrobetaine + 2-oxoglutarate + oxygen -> L-carnitine + succinate + CO2, gibberellin A1 + 2-oxoglutarate + oxygen -> gibberellin A8 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A110 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A14 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A15 (open lactone form) + CO2 + succinate, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A15 (open lactone form) + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A53 + succinate + CO2, gibberellin A14 + 2-oxoglutarate + oxygen -> gibberellin A37 + CO2 + succinate, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A24 + CO2 + succinate + H2O, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A24 + succinate + CO2 + H2O, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A37 + succinate + CO2, gibberellin A19 + 2-oxoglutarate + oxygen -> gibberellin A17 + succinate + CO2 + H+, gibberellin A19 + 2-oxoglutarate + oxygen -> gibberellin A20 + 2 CO2 + succinate + H+, gibberellin A20 + 2-oxoglutarate + oxygen -> gibberellin A1 + succinate + CO2, gibberellin A20 + 2-oxoglutarate + oxygen -> gibberellin A29 + succinate + CO2, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A25 + CO2 + succinate + H+, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A36 + succinate + CO2, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A9 + 2 CO2 + succinate + H+, gibberellin A25 + 2-oxoglutarate + oxygen -> gibberellin A13 + succinate + CO2, gibberellin A29 + 2-oxoglutarate + oxygen -> gibberellin A29-catabolite + succinate + CO2 + H+ + H2O, gibberellin A34 + 2-oxoglutarate + oxygen -> gibberellin A34-catabolite + succinate + CO2 + H+ + H2O, gibberellin A36 + 2-oxoglutarate + NADP+ + oxygen -> gibberellin A4 + succinate + 2 CO2 + NADPH, gibberellin A37 + 2-oxoglutarate + oxygen -> gibberellin A36 + succinate + CO2 + H2O, gibberellin A4 + 2-oxoglutarate + oxygen -> gibberellin A34 + succinate + CO2, gibberellin A44 (closed lactone form) + 2-oxoglutarate + 2 H+ + oxygen -> gibberellin A98 + succinate + CO2, gibberellin A5 + 2-oxoglutarate + oxygen -> gibberellin A3 + succinate + CO2, gibberellin A5 + 2-oxoglutarate + oxygen -> gibberellin A6 + succinate + CO2, gibberellin A51 + 2-oxoglutarate + oxygen -> gibberellin A51-catabolite + succinate + CO2 + H+ + H2O, gibberellin A53 + 2-oxoglutarate + oxygen -> gibberellin A97 + succinate + CO2, gibberellin A53 + 2-oxoglutarate + oxygen -> gibberellin44 (open lactone form) + CO2 + succinate, gibberellin A8 + 2-oxoglutarate + oxygen -> gibberellin A8-catabolite + succinate + CO2 + H+ + H2O, gibberellin A9 + 2-oxoglutarate + oxygen -> gibberellin A4 + succinate + CO2, gibberellin A9 + 2-oxoglutarate + oxygen -> gibberellin A51 + succinate + CO2, gibberellin44 (open lactone form) + 2-oxoglutarate + H+ + oxygen -> gibberellin A38 + succinate + CO2 + H2O, gibberellin44 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A19 + succinate + CO2 + H2O, L-arginine + 2-oxoglutarate + oxygen -> (3S)-3-hydroxy-L-arginine + succinate + CO2, L-cysteine + O-succinyl-L-homoserine <--> succinate + L-cystathionine + H+, luteoforol + 2-oxoglutarate + oxygen + H+ -> luteolinidin + succinate + CO2 + 2 H2O, mugineate + 2-oxoglutarate + oxygen -> 3-epihydroxymugineate + succinate + CO2, N6,N6,N6-trimethyl-L-lysine + 2-oxoglutarate + oxygen -> 3-hydroxy-N6,N6,N6-trimethyl-L-lysine + succinate + CO2, N-succinyl-L,L-2,6-diaminopimelate + H2O -> L,L-diaminopimelate + succinate, oripavine + 2-oxoglutarate + oxygen -> morphinone + formaldehyde + succinate + CO2, O-succinyl-L-homoserine + L-cysteine <--> L-cystathionine + succinate + H+, pentalenolactone D + 2-oxoglutarate + oxygen -> pentalenolactone E + succinate + CO2 + H2O, pentalenolactone E + 2-oxoglutarate + oxygen -> pentalenolactone F + succinate + CO2, succinate + ATP + coenzyme A <--> succinyl-CoA + ADP + phosphate, succinate + GTP + coenzyme A <--> succinyl-CoA + GDP + phosphate, succinate semialdehyde + NAD+ + H2O -> succinate + NADH + 2 H+, thebaine + 2-oxoglutarate + oxygen -> neopinone + formaldehyde + succinate + CO2, thebaine + 2-oxoglutarate + oxygen -> oripavine + formaldehyde + succinate + CO2, trans-caffeoyl-CoA + 2-oxoglutarate + oxygen -> 2,4,6-trihydroxycinnamoyl-CoA + succinate + CO2. Spiral Buffet Promo October 2020, Toilet Spray Woolworths, Center-cut Pork Rib Chops, Mounting Rooftop Tent To Pioneer Platform, German Shepherd Front Dew Claws, ..." /> grip 2 step folding stool

grip 2 step folding stool

98.0 % Purity(Neutralization titration) min. Environmental: Succinic acid is not expected to volatilize from water surfaces. Acid (Propanedioic Product name : Succinic Acid CAS-No. 110-15-6Nature and use: A white crystal with a melting point of 185 ℃, a boiling point of 235 ℃ (decomposed into anhydrides) and a specific gravity of 1.572. fluids, surfactants, lubricants, detergents, oiling agents, emulsifiers, wetting In pharm. & MALEIC ACID, GENERAL Articles of Succinic acid are included as well. Properties: Odorless, monoclinic prisms; very acid taste; d 1.56; mp 185-187°; bp 235° with partial conversion into the anhydride. 8, Suberic C at 15 mmHg, C - 128 C, C The melting temperature of succinic acid is 185 - 187 °C. esters are used as in a variety of direct and indirect applications. "Succinic Acid" is useful, non-toxic, stable and harmless to the human body. The excess alkene is removed by distillation in vacuo, the resulting alkenyl succinic anhydride hydrolyzed with dilute sodium hydroxide solution and the disodium salt reacted with an acid to achieve an alkenebutanedioic acid. Succinic Acid 99,7. LLA was sublimated under nitrogen before use. 3, Malonic Environmental: Succinic acid is not expected to volatilize from water surfaces. Sulfapyridine Melting Point Standard (1 g) (Approximately 191 degrees) DISCONTINUED: This item has been discontinued and is no longer available for purchase. Chemsrc provides 2-Dodecen-1-yl succinic anhydride(CAS#:19780-11-1) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. Linear Formula: HOOCCH 2 CH 2 COOH. selections. Succinic Acid Melting Point Standard United States Pharmacopeia (USP) Reference Standard; find USP-1623422 MSDS, related peer-reviewed papers, technical documents, similar products & more at Sigma-Aldrich. MAXIMUM ALLOWABLE Insoluble matter: 0.01% Residue after ignition: 0.02% Chloride (Cl): 0.001% Phosphate (PO4): 0.001% Sulfate (SO4): 0.003% Contents. Point, Boiling CAS number. for the manufacture of a variety of target compounds. industry, succinic acid high grade is used in the production of synthetic tranquilizer, contraceptive, cancer drugs, etc. MP of succinic acid is 188-190 C and MP of adipic acid is 152-154 C. I would think adipic acid has a higher melting point due to its higher molar mass, but this is … Succinic anhydride hydrolyzes readily to give succinic acid: 110-15-6 Molecular formula C4H6O4 Molecular Weight 118.09 Appearance colorless to white crystal or white crystal powder Purity ≥ 99.5% Melting range 184.0~187.0°C Chloride ≤ 0.007% Sulphate (SO42-) - 103 C, 237 Help . Other names. DESCRIPTION. Often you don’t even need to prepare a fresh sample, because after cooling the melted sample ... Succinic acid 184-185 Learning goals: • Learn how to run a melting point device and measure melting range IN WATER, Health: Succinic acid has a melting point of 185°C and a boiling point of 235°C. Melting point 237°F. Substances to be avoided include strong bases,strong oxidizing agents. Flavoring Soluble in alcohol, methanol, colourless odourless prisms or white crystalline powder. Product Name & Other Names: Succinic Acid or Butanedioic acid. Succinic acid. The almost infinite esters Does anyone know? MP and SA were used without further purification. Acid (Butanedioic Acid) is a dicarboxylic An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. Get info of suppliers, manufacturers, exporters, traders of Succinic Acid for buying in India. Succinic acid IUPAC systematic name: butanedioic acid; historically known as spirit of amber[2]) is a diprotic, dicarboxylic acid withchemical formula C4H6O4 and structural formula HOOC-(CH2)2-COOH. View the Full Spectrum for FREE! Other names. Appearance: White powder to crystal: Purity(GC) min. … Succinic acid monoethyl ester chloride Product group Carboxylic acid chlorides Synonyms 3-chlorocarbonyl propionic acid ethyl ester Ethyl-4-chloro-4-oxobutyrate Succinyl chloride ethyl ester Ethyl succinyl monochloride IUPAC name Succinic acid monoethyl ester chloride Appearance Clear liquid Applications Intermediate for the synthesis of pharmaceuticals (e.g. Succinic Acid is widely used in industry Like Food Inductry, Pharmaceutical Industry, Adhesive Succinate is a component of the citric acid cycle and is capable of donating electrons to the electron … Succinic Acid CAS NO. Food Grade Succinic Acid Supplement , Bio Succinic Acid High Melting Point. Find here online price details of companies selling Succinic Acid. C Display Name: Succinic acid EC Number: 203-740-4 EC Name: Succinic acid CAS Number: 110-15-6 Molecular formula: C4H6O4 IUPAC Name: butanedioic acid coatings. Application of Succinin Acid : Succinic acid 99.5% is used to produce dye, alkyd resin, pesticides and so on. Related Products. Stable. It is a diprotic acid. SpectraBase Compound ID: l9lM5r2ysb: Mol Weight: 0.0 g/mol: Molecular Formula: C4H6O4: Exact Mass: 0.0 g/mol: Transmission Infrared (IR) Spectrum. More>> Succinic acid for synthesis. Chemsrc provides Diammonium succinate(CAS#:2226-88-2) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. Carboxylic acid can infinite esters obtained from carboxylic All India; Mumbai; Bio-Tech Grade Powder … It does not dissolve in benzene, carbon sulfide, carbon tetrachloride or oil ether. ILO International Chemical Safety Cards (ICSC) 3.2.4 Flash Point. Succinic Succinic acid, also called Butanedioic Acid, a dicarboxylic acid of molecular formula C 4 H 6 O 4 that is widely distributed in almost all plant and animal tissues and that plays a significant role in intermediary metabolism. Succinic acid can also be produced via anaerobic fermentation, especially from sources like starch and different C5 and C6 sugars (Werpy et al., 2006).A very prominent example is the microorganism Basfia succiniciproducens, which was extracted from a cow rumen (Scholten et al., 2009).The specific feature of the microorganism is the consumption of one molecule of carbon dioxide in each molecule of succinic … Acid(Nonanedioic Acid), 100 14, 126 CAS: 110-15-6 MDL: MFCD00002789 EINECS: 203-740-4 Synonyms: 1,4-Butanedioic acid Biological buffers are useful for cell culture in vitro, enzyme assays and … Chemsrc provides Succinic acid(CAS#:110-15-6) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. Succinic - 129 C, 245 7, Pimelic PHYSICAL - 114 C, C Succinic acid Butanediol: Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Less<< Succinic acid MSDS (material safety data sheet) or SDS, CoA and CoQ, dossiers, brochures and other available documents. 6, Adipic The carboxylate anion is called 'succinate and esters of succinic acid are called alkyl succinates. Succinic acid is a colorless crystalline solid with a melting point of 185-187° C. It is soluble in water, slightly dissolves in ethanol, ether, acetone and glycerine. # DEREK, a knowledge-based systemr epeatedly cited in the Guidance on information requirements and chemical safety assessment, Chapter R.6 "QSARs and grouping of chemicals" was applied to succinic acid and also to the chemically analogous substances fumaric acid and maleic acid. Does anyone know? at 100 mmHg, C Point, C Type of study provided. Specifications of Succinic Acid Analytical Reagent Grade: Butanedioic Acid HOOCCH2CH2COOH --- Formula Weight 118.09 CAS Number 110-15-6. REQUIREMENTS Assay: 99.0% HOOCCH2CH2COOH Melting point: 185C-191C . photographic chemicals, alkyd resins, plasticizer, Metal treatment chemical, vehicle water cooling systems and 186-188 °C Alfa Aesar: 185 °C Indofine [15-0400] , [15-0400] : 185 °C OU Chemical Safety Data (No longer updated) More details: 184-189 °C Merck Millipore 3821, 822260: 185 °C Jean-Claude Bradley Open Melting Point Dataset 16121: 186.5 °C Jean-Claude Bradley Open Melting Point Dataset 16582: 188 °C Jean-Claude Bradley Open Melting Point Dataset 13519, 22290, 28530 It is soluble in water and slightly soluble in ethanol for the preparation of pentaheterocyclic compounds.Specification:Test ItemsSp Acid(Pentanedioic Information on Registered Substances comes from registration dossiers which have been assigned a registration number. Preparation. Succinic Acid or Butanedioic Acid SDS, Safety Data Sheet MSDS, Material Safety Data Sheet 20-Nov-20. … New Window-21.0 °C. Amber Acid. vitamins) and agrochemicals … C at 10 mmHg, C Practically insol in benzene, carbon disulfide, carbon tetrachloride, petr ether. CopyCopied, CSID:1078, http://www.chemspider.com/Chemical-Structure.1078.html (accessed 23:41, Jan 7, 2021) The melting point (T m), heat of fusion ΔH m ... L-Lactide (LLA), succinic acid (SA) and 2-methyl-1,3-propanediol (MP) were purchased from Tokyo Chemical Industry. amides, and nitriles for the application of drug, Melting point 237°F. Butanedioic acid, 2-phenyl-10424-29-0. 2. IndiaMART. EINECS 211-238-1. point, and other physical and chemical properties for the proper application 9, Azelaic Chemsrc provides Succinic acid(CAS#:110-15-6) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. CAMEO Chemicals. MFCD00004256.alpha.-Phenylsuccinic acid. carbon sulfide, carbon tetrachloride and oil ether. C, 302 Succinic acid has a melting point of 185 °C and a boiling point of 235 °C. Molecular formula of anthracene = C 18 H 10. 90 °C c.c. 16, 124 Succinic acid CAS 110-15-6 cryst., EMPROVE® ESSENTIAL NF,JPE,ACS - Find MSDS or SDS, a COA, data sheets and more information. Articles of Diammonium succinate are included as well. 18 Products. Download MSDS File. Melting Points of Urea and Succinic Acid 1. Succinic anhydride is a cyclic dicarboxylic anhydride and a tetrahydrofurandione. SECTION 1. 2-Phenyl-succinic acid. Acid(Heptanedioic Acid), 105 18, Octadecanedioic oxidized to carbon dioxide and water to provide energy in the form of C, C Succinic Acid of NIPPON SHOKUBAI has not only been used as food additives but also biodegradable polymers, bath additives, plating agents, photochemicals and so on. There are almost Specifications of Succinic Acid Analytical Reagent Grade: Butanedioic Acid HOOCCH2CH2COOH --- Formula Weight 118.09 CAS Number 110-15-6. EPA DSSTox-21°C. Butanedioic acid, phenyl-Succinic acid, phenyl-2-Phenylsuccinate. length (Straight), CAS 1.3 Details of the supplier of the safety data sheet Company : Central Drug House (P) Ltd 7/28 Vardaan House New Delhi-10002 INDIA Telephone : +91 11 49404040 Email : care@cdhfinechemical.com 1.4 … PRODUCT IDENTIFICATION. New Window. in intermediary metabolism (Krebs cycle) in the body. The common method of synthesis of succinic acid is the catalytic hydrogenation of maleic acid or its anhydride. 3.2.3 Melting Point. 3 Chemical and Physical Properties Expand this … Polybutylene succinate (PBS), classed as biopolymer, was synthesized by condensation of succinic acid with a lower excess of (1, 4) butanediol. C at 15 mmHg, C Succinic acid (HOOCCH 2 CH 2 COOH) is a dicarboxylic acid which plays an important role in the citric acid cycle.The name comes from Latin succinum, meaning amber, from which the acid was first isolated.The carboxylate anion is called succinate. Phenylsuccinicacid. Determine the melting point range of urea, then the melting point range of succinic acid . - 134 One gram dissolves in 13 ml cold water, 1 ml boiling water, 18.5 ml alcohol, 6.3 ml methanol, 36 ml acetone, 20 ml glycerol, 113 ml ether. - 110 C, C - 144 c acid cycle. Esters Moderately toxic and an irritant. The monograph also details the following specifications and corresponding tests for verifying that a substance meets ACS Reagent Grade specifications including: Assay, Melting Point, Insoluble … ether, acetone and glycerine; not dissolved in benzene, The common method of synthesis of succinic acid is the The carboxylate anion is called succinate and esters of succinic acid are called alkyl succinates. Succinic acid, (HOOCCH 2 CH 2 COOH), is a dicarboxylic acid which plays an important role in the citric acid cycle.The name comes from Latin succinum, meaning amber, from which the acid was first isolated.The carboxylate anion is called succinate. Phenylsuccinate. ILO International Chemical Safety Cards (ICSC) 3.2.5 Solubility. 5, Glutaric sequence process of enzymatic reaction which a two-carbon acetyl unit is acid, arboxylic acid can 1 Structures Expand this section. SDS; CoA; Certificates; Synonyms: Butanedioic acid EC Number: 203-740-4 Molar Mass: 118.09 g/mol Chemical Formula: HOOCCH₂CH₂COOH CAS #: 110 … C&L Inventory . THF and toluene were purchased from … Human Metabolome Database (HMDB)-21 °C. coupling agents. Succinic acid - cas 110-15-6, synthesis, structure, density, melting point, boiling point acid of four carbon atoms. Acid(Butanedioic Acid), 185 The full spectrum can only be viewed using a FREE account. However, under the "many useful applications" described for the products obtained, the use as a size has not yet been mentioned. Infobox references: Polybutylene succinate (PBS) (sometimes written polytetramethylene succinate) is a thermoplastic polymer resin of … It derives from a succinic acid. AND CHEMICAL PROPERTIES, moderately Synonym: Butanedioic acid CAS Number: 110-15-6. As a good "C4" platform compounds, Succinic acid has been widely used in food, chemical, pharmaceutical industry and other fields. Succinic acid can also be used as analytical reagent and flavoring agents. Tetrahydrofuran (THF) was used as an eluent at a flow rate of 1.0 mL/min at 40 °C. CAS Number: 110-15-6 EINECS EC Number: 203-740-4 Molecular Formula: HOOCCH2CH2COOH Molecular Weight: 118.09 Relevant uses and uses advised against (if any): Industrial Manufacturing. IDENTIFICATION, GENERAL pH of 0.1 molar aq soln 2.7. Reactions. Biochemical role. DESCRIPTION OF, Propanedioic Succinic acid is a colourless crystalline solid with a melting point of 185 -187 C; soluble in water; slightly dissolved in ethanol, ether, acetone and glycerine; not dissolved in benzene, carbon sulfide, carbon tetrachloride and oil ether. CopyCopied, KDYFGRWQOYBRFD-UHFFFAOYSA-N 110-15-6. ChEBI. catalytic hydrogenation of maleic acid or its anhydride. C, 230 Succinic Acid (75 products available) View by: Product | Supplier. to white crystalline power, HEAVY METAL (As Pb Succinic Acid CAS NO. are formed by removal of water from an acid and an alcohol. Physical: Vapor-phase succinic acid is degraded in the atmosphere by reaction with photochemically-produced hydroxyl radicals; the half-life for this reaction in air is estimated to be about 5.8 days. I'm looking at their structures, and they're practically identical, except succinic acid has a (CH2)2 group and adipic acid has (CH2)4 in the middle of their structures, but succinic acid has a much higher melting point. - 99 It is a diprotic acid. This monograph for Succinic Acid provides, in addition to common physical constants, a general description including typical appearance, applications, change in state (approximate), aqueous solubility, and pKa. uses. … Acid (Hexanedioic Acid), 151 Carboxylic acid Succinic acid CAS No. Insoluble Solubility in chloroform: Soluble Related compounds Related Monomers. Organic Compound; Drug; Food Toxin; Dietary Supplement; Micronutrient; Metabolite; Nutraceutical; Animal Toxin; Natural Compound; Supplement, ORL-RAT LD50 2260 mg kg-1, IPR-MUS LD50 2702 mg kg-1, IVN-MUS LD50 1400 mg kg-1, P261-P280-P305+P351+P338-P304+P340-P405-P501a, WARNING: Causes GI injury, skin and eye irritation. Sublimes at 239°F at 5 mm Hg pressure; and at 198°F and 1 mm Hg pressure. Under these conditions, it is possible to substitute succinic acid for its anhydride obtaining the same results. Melting Point >186ºC (dec.) Molecular Weight: 122.06: Storage: Refrigerator: Solubility: Methanol (Slightly), Water (Slightly) Category: Building Blocks; Isotopic Labeled Analogues; Applications: Succinic Acid-13C4 is a compound useful in organic synthesis. Higher chain compounds are used as components in metalworking Succinic anhydride appears as colorless needles or white crystalline solid. Molecular Weight: 118.09 . Melting Point ℃ 185 min. Other identifiers. agents textile treatments and emollients, They are also used as intermediates 10, Sebacic provide a wide range of viscosity, specific gravity, vapor pressure, boiling 30% higher reaction yields were achieved with … Colorless acyl halides, anhydrides, esters, Human Metabolome Database (HMDB) Solubility in water, g/100ml … It has a melting point of 185 °C and a boiling point of 235 °C. C, C Moderately toxic and an irritant. Succinic acid is a kind of common natural organic acid, due to it’s from amber distilled in 1550 for the first time, so the Succinic acid is also known as Amber acid. Get Best Price. Location. 119.5 °C Jean-Claude Bradley Open Melting Point Dataset 15725: 119 °C Jean-Claude Bradley Open Melting Point Dataset 20509: 120 °C Jean-Claude Bradley Open Melting Point Dataset 8430: 118-121 °C Alfa Aesar A12245: 118-120 °C SynQuest 59334, 118-120 °C Oakwood [339548] 119 °C FooDB FDB010338: 118-120 °C SynQuest 59334, 2H26-1-X5 Quality Management Dossier; Operational Excellence Dossier; SDS; CoA; Certificates ; Material Qualification Dossier; Synonyms: Butanedioic acid Molar Mass: 118.09 g/mol Chemical Formula: HOOCCH₂CH₂COOH EC Number: 203-740-4 Hill Formula: C₄H₆O₄ CAS #: 110-15-6 … An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. 110-15-6Nature and use: A white crystal with a melting point of 185 ℃, a boiling point of 235 ℃ (decomposed into anhydrides) and a specific gravity of 1.572. It occurs naturally in plant Physical: Vapor-phase succinic acid is degraded in the atmosphere by reaction with photochemically-produced hydroxyl radicals; the half-life for this reaction in air is estimated to be about 5.8 days. REQUIREMENTS Assay: 99.0% HOOCCH2CH2COOH Melting point: 185C-191C . 19.1 mg/mL at 25 °C. The assignment of a registration number does however not guarantee that the information in the dossier is … This monograph for Succinic Acid provides, in addition to common physical constants, a general description including typical appearance, applications, change in state (approximate), aqueous solubility, and pKa. CopyCopied, InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) Acid), Pentanedioic #, Melting C(CC(=O)O)C(=O)O At room temperature, pure succinic acid is a solid that forms colorless, odorless crystals. Near Me. Melting point: 115 °C (239 °F; 388 K) Solubility in water. Item Unit Specification; Appearance--White crystalline powder: Assay % 99.0 min. IndiaMART > Pharma Ingredients & Raw Materials > API Intermediate > Succinic Acid. and animal tissues. 15, C Acid). It is a colourless crystalline solid, soluble in water, with a … It is a white, odorless solid. Help. 0.11 M. EPA . The method does not seem to give con­ sistent yields and, therefore, we have employed zinc chloride as the condensing agent instead, using a temperature of 170-80°. 2, 189 ... Melting/freezing point at 101 325 Pa provides information on the substance melting/freezing point in °C at a pressure of 101 325 Pa. - 153 Acid(Decanedioic Acid), 131 melting point” quickly, and then repeat with more care for a more precise reading. It is soluble in water and slightly soluble in ethanol for the preparation of pentaheterocyclic compounds.Specification:Test ItemsSp agriculture, and food products, and other industrial Succinic acid is a colourless crystalline solid with a melting point of 185 -187 C; soluble in … 99.0 % Melting point: 185.0 to 189.0 °C: Solubility in hot Water Succinic Acid is industrially produced by hydrogenation of Maleic Anhydride. 13, 112 esters are used as flavouring base materials, plasticizers, solvent carriers and rmediate metabolite in the citric acid cycle. yield Sigma-Aldrich offers a number of Succinic acid products. Physical-chemical properties. PRODUCT Packing: in 25kg bags All Products. DEREK did not find any substructures in its database that fired an alert that would predict succinic acid to be toxic or … In the laboratory, this material can be prepared by dehydration of succinic acid.Such dehydration can occur with the help of acetyl chloride or phosphoryl chloride, or thermally.. Industrially, succinic anhydride is prepared by catalytic hydrogenation of maleic anhydride.. It was discovered in the year 1550 when Dr.Agricola with Germany distilled amber. Acid), C 11, 109 C, C (-)-4'-desmethyl-epipodophyllotoxin biosynthesis, 2-oxoglutarate + L-arginine + oxygen -> succinate + CO2 + guanidinium + (S)-1-pyrroline-5-carboxylate + H2O + H+, 3 2-oxoglutarate + L-arginine + 3 oxygen + 3 H+ -> 2 ethene + 7 CO2 + succinate + guanidinium + (S)-1-pyrroline-5-carboxylate + 3 H2O, a (2R,3S,4S)-leucoanthocyanidin + 2-oxoglutarate + oxygen + H+ -> an anthocyanidin with a 3-hydroxy group + succinate + CO2 + 2 H2O, aerobic respiration III (alternative oxidase pathway), anthocyanin biosynthesis (delphinidin 3-O-glucoside), anthocyanin biosynthesis (pelargonidin 3-O-glucoside), fumarate[in] + a menaquinol[membrane] -> succinate[in] + a menaquinone[membrane], fumarate[in] + a rhodoquinol[membrane] -> succinate[in] + a rhodoquinone[membrane], fumarate[in] + an electron-transfer quinol[membrane] -> succinate[in] + an electron-transfer quinone[membrane], gibberellin biosynthesis I (non C-3, non C-13 hydroxylation), gibberellin biosynthesis II (early C-3 hydroxylation), gibberellin biosynthesis III (early C-13 hydroxylation), gibberellin inactivation I (2beta-hydroxylation), homocysteine and cysteine interconversion, hydroxylated mugineic acid phytosiderophore biosynthesis, leucopelargonidin and leucocyanidin biosynthesis, pentalenolactone D + 2 2-oxoglutarate + 2 oxygen -> pentalenolactone F + 2 succinate + 2 CO2 + H2O, polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium), polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium), proanthocyanidins biosynthesis from flavanols, succinate[in] + a ubiquinone[membrane] -> fumarate[in] + an ubiquinol[membrane], succinate[in] + an electron-transfer quinone[membrane] -> fumarate[in] + an electron-transfer quinol[membrane], succinate[mitochondrial lumen] + a ubiquinone[mitochondrial lumen] -> fumarate[mitochondrial lumen] + an ubiquinol[mitochondrial lumen], superpathway of glyoxylate cycle and fatty acid degradation, superpathway of hyoscyamine and scopolamine biosynthesis, superpathway of scopolin and esculin biosynthesis, (-)-yatein + 2-oxoglutarate + oxygen -> (-)-deoxypodophyllotoxin + succinate + CO2 + H2O, (+)-dihydrokaempferol + 2-oxoglutarate + oxygen -> kaempferol + succinate + CO2 + H2O + H+, (+)-dihydromyricetin + 2-oxoglutarate + oxygen -> myricetin + succinate + CO2 + H2O, (+)-taxifolin + 2-oxoglutarate + oxygen -> quercetin + succinate + CO2 + H2O, (2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + oxygen -> delphinidin + CO2 + succinate + H+ + 2 H2O, (2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + oxygen -> (4S)-2,3-dehydroleucopelargonidin + succinate + CO2 + H2O + 2 H+, (2S)-dihydrotricetin + 2-oxoglutarate + oxygen -> (+)-dihydromyricetin + succinate + CO2, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> (+)-taxifolin + CO2 + succinate, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> (+)-taxifolin + succinate + CO2, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> luteolin + succinate + CO2 + H2O, (2S)-naringenin + 2-oxoglutarate + oxygen -> (+)-dihydrokaempferol + succinate + CO2, (2S)-naringenin + 2-oxoglutarate + oxygen -> apigenin + succinate + CO2 + H2O + H+, (2S)-naringenin + 2-oxoglutarate + oxygen -> CO2 + succinate + (+)-dihydrokaempferol, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> (+)-pinobanksin + CO2 + succinate, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> (+)-pinobanksin + succinate + CO2, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> chrysin + succinate + CO2 + H2O, (6S)-hydroxyhyoscyamine + 2-oxoglutarate + oxygen -> scopolamine + succinate + CO2 + H+ + H2O, (S)-atropinium + 2-oxoglutarate + oxygen -> (6S)-hydroxyhyoscyamine + succinate + CO2, (S)-dihydroorotate + fumarate -> orotate + succinate, 2'-deoxymugineate + 2-oxoglutarate + oxygen -> 3-epihydroxy-2'-deoxymugineate + succinate + CO2 + H+, 2'-deoxymugineate + 2-oxoglutarate + oxygen -> mugineate + succinate + CO2 + H+, 2-oxoglutarate + (S)-atropinium + oxygen -> CO2 + succinate + (6S)-hydroxyhyoscyamine, 2-oxoglutarate + 3,7,4'-trimethylquercetin + 3,7,4'-trimethylquercetin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + 3,7,4'-trimethylquercetagetin + succinate + CO2, 2-oxoglutarate + 3,7-dimethylquercetin + 3,7-dimethylquercetin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + 3,7-dimethylquercetagetin + 3,7-dimethylquercetagetin + succinate + CO2, 2-oxoglutarate + 8-hydroxy-salvigenin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + formaldehyde + pilosin + formaldehyde + succinate + CO2, 2-oxoglutarate + apiforol + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + apigeninidin + succinate + CO2 + 2 H2O + 2 H2O, 2-oxoglutarate + desacetoxyvindoline + oxygen -> CO2 + succinate + 17-O-deacetylvindoline, 2-oxoglutarate + gardenin B + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + formaldehyde + nevadensin + formaldehyde + succinate + CO2, 2-oxoglutarate + luteoforol + 2-oxoglutarate + H+ + oxygen + oxygen + H+ -> CO2 + succinate + luteolinidin + succinate + CO2 + 2 H2O + 2 H2O, 3,7,4'-trimethylquercetin + 2-oxoglutarate + oxygen -> 3,7,4'-trimethylquercetagetin + succinate + CO2, 4-coumaroyl-CoA + 2-oxoglutarate + oxygen -> 2,4-dihydroxycinnamoyl-CoA + succinate + CO2, a (2R,3S,4S)-leucoanthocyanidin + 2-oxoglutarate + oxygen -> a (4S)- 2,3-dehydroflavan-3,4-diol + succinate + CO2 + H2O, apiforol + 2-oxoglutarate + oxygen -> apigeninidin + succinate + CO2 + 2 H2O, codeine + 2-oxoglutarate + oxygen -> morphine + formaldehyde + succinate + CO2, desacetoxyvindoline + 2-oxoglutarate + oxygen -> 17-O-deacetylvindoline + succinate + CO2, desacetoxyvindorosine + 2-oxoglutarate + oxygen -> deacetylvindorosine + succinate + CO2, DIBOA-beta-D-glucoside + 2-oxoglutarate + oxygen -> TRIBOA-beta-D-glucoside + succinate + CO2, D-threo-isocitrate -> glyoxylate + succinate, ferulate + 2-oxoglutarate + oxygen -> (E)-6'-hydroxyferulate + succinate + CO2, feruloyl-CoA + 2-oxoglutarate + oxygen -> 6'-hydroxyferuloyl-CoA + succinate + CO2, fumarate[in] + 2 H+[in] + 2 e-[membrane] -> succinate[in], gamma-butyrobetaine + 2-oxoglutarate + oxygen -> L-carnitine + succinate + CO2, gibberellin A1 + 2-oxoglutarate + oxygen -> gibberellin A8 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A110 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A14 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A15 (open lactone form) + CO2 + succinate, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A15 (open lactone form) + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A53 + succinate + CO2, gibberellin A14 + 2-oxoglutarate + oxygen -> gibberellin A37 + CO2 + succinate, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A24 + CO2 + succinate + H2O, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A24 + succinate + CO2 + H2O, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A37 + succinate + CO2, gibberellin A19 + 2-oxoglutarate + oxygen -> gibberellin A17 + succinate + CO2 + H+, gibberellin A19 + 2-oxoglutarate + oxygen -> gibberellin A20 + 2 CO2 + succinate + H+, gibberellin A20 + 2-oxoglutarate + oxygen -> gibberellin A1 + succinate + CO2, gibberellin A20 + 2-oxoglutarate + oxygen -> gibberellin A29 + succinate + CO2, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A25 + CO2 + succinate + H+, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A36 + succinate + CO2, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A9 + 2 CO2 + succinate + H+, gibberellin A25 + 2-oxoglutarate + oxygen -> gibberellin A13 + succinate + CO2, gibberellin A29 + 2-oxoglutarate + oxygen -> gibberellin A29-catabolite + succinate + CO2 + H+ + H2O, gibberellin A34 + 2-oxoglutarate + oxygen -> gibberellin A34-catabolite + succinate + CO2 + H+ + H2O, gibberellin A36 + 2-oxoglutarate + NADP+ + oxygen -> gibberellin A4 + succinate + 2 CO2 + NADPH, gibberellin A37 + 2-oxoglutarate + oxygen -> gibberellin A36 + succinate + CO2 + H2O, gibberellin A4 + 2-oxoglutarate + oxygen -> gibberellin A34 + succinate + CO2, gibberellin A44 (closed lactone form) + 2-oxoglutarate + 2 H+ + oxygen -> gibberellin A98 + succinate + CO2, gibberellin A5 + 2-oxoglutarate + oxygen -> gibberellin A3 + succinate + CO2, gibberellin A5 + 2-oxoglutarate + oxygen -> gibberellin A6 + succinate + CO2, gibberellin A51 + 2-oxoglutarate + oxygen -> gibberellin A51-catabolite + succinate + CO2 + H+ + H2O, gibberellin A53 + 2-oxoglutarate + oxygen -> gibberellin A97 + succinate + CO2, gibberellin A53 + 2-oxoglutarate + oxygen -> gibberellin44 (open lactone form) + CO2 + succinate, gibberellin A8 + 2-oxoglutarate + oxygen -> gibberellin A8-catabolite + succinate + CO2 + H+ + H2O, gibberellin A9 + 2-oxoglutarate + oxygen -> gibberellin A4 + succinate + CO2, gibberellin A9 + 2-oxoglutarate + oxygen -> gibberellin A51 + succinate + CO2, gibberellin44 (open lactone form) + 2-oxoglutarate + H+ + oxygen -> gibberellin A38 + succinate + CO2 + H2O, gibberellin44 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A19 + succinate + CO2 + H2O, L-arginine + 2-oxoglutarate + oxygen -> (3S)-3-hydroxy-L-arginine + succinate + CO2, L-cysteine + O-succinyl-L-homoserine <--> succinate + L-cystathionine + H+, luteoforol + 2-oxoglutarate + oxygen + H+ -> luteolinidin + succinate + CO2 + 2 H2O, mugineate + 2-oxoglutarate + oxygen -> 3-epihydroxymugineate + succinate + CO2, N6,N6,N6-trimethyl-L-lysine + 2-oxoglutarate + oxygen -> 3-hydroxy-N6,N6,N6-trimethyl-L-lysine + succinate + CO2, N-succinyl-L,L-2,6-diaminopimelate + H2O -> L,L-diaminopimelate + succinate, oripavine + 2-oxoglutarate + oxygen -> morphinone + formaldehyde + succinate + CO2, O-succinyl-L-homoserine + L-cysteine <--> L-cystathionine + succinate + H+, pentalenolactone D + 2-oxoglutarate + oxygen -> pentalenolactone E + succinate + CO2 + H2O, pentalenolactone E + 2-oxoglutarate + oxygen -> pentalenolactone F + succinate + CO2, succinate + ATP + coenzyme A <--> succinyl-CoA + ADP + phosphate, succinate + GTP + coenzyme A <--> succinyl-CoA + GDP + phosphate, succinate semialdehyde + NAD+ + H2O -> succinate + NADH + 2 H+, thebaine + 2-oxoglutarate + oxygen -> neopinone + formaldehyde + succinate + CO2, thebaine + 2-oxoglutarate + oxygen -> oripavine + formaldehyde + succinate + CO2, trans-caffeoyl-CoA + 2-oxoglutarate + oxygen -> 2,4,6-trihydroxycinnamoyl-CoA + succinate + CO2.

Spiral Buffet Promo October 2020, Toilet Spray Woolworths, Center-cut Pork Rib Chops, Mounting Rooftop Tent To Pioneer Platform, German Shepherd Front Dew Claws,